C27H29ClN6O5 — CID 19091497
1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate (PubChem CID 19091497) has the molecular formula C27H29ClN6O5 and a molecular weight of 553.02 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 19091497 |
| Molecular Formula | C27H29ClN6O5 |
| Molecular Weight | 553.02 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OC(C)OC(=O)OCC)n1Cc1ccc(-c2ccccc2)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C27H29ClN6O5/c1-4-6-12-22-29-24(28)23(26(35)38-17(3)39-27(36)37-5-2)34(22)16-18-13-14-20(19-10-8-7-9-11-19)21(15-18)25-30-32-33-31-25/h7-11,13-15,17H,4-6,12,16H2,1-3H3,(H,30,31,32,33) |
| InChIKey | QCNNWZSXBDCFRU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.02 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|