C31H36ClN7O7 — CID 89057501
1-[(5S)-5-nitrooxyheptanoyl]oxyethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 89057501) has the molecular formula C31H36ClN7O7 and a molecular weight of 654.12 g/mol. Its IUPAC name is 1-[(5S)-5-nitrooxyheptanoyl]oxyethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 1-[(5S)-5-nitrooxyheptanoyl]oxyethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 89057501 |
| Molecular Formula | C31H36ClN7O7 |
| Molecular Weight | 654.12 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | 1-[(5S)-5-nitrooxyheptanoyl]oxyethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OC(C)OC(=O)CCC[C@H](CC)O[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H36ClN7O7/c1-4-6-13-26-33-29(32)28(31(41)45-20(3)44-27(40)14-9-10-23(5-2)46-39(42)43)38(26)19-21-15-17-22(18-16-21)24-11-7-8-12-25(24)30-34-36-37-35-30/h7-8,11-12,15-18,20,23H,4-6,9-10,13-14,19H2,1-3H3,(H,34,35,36,37)/t20?,23-/m0/s1 |
| InChIKey | IJTGGAUNMPHCRC-AKRCKQFNSA-N |
| XLogP | 5.98 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.12 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|