C32H38ClN9O5 — CID 89167867
1-[4-[(E)-pyrrolidin-1-yldiazenyl]oxybutanoyloxy]ethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 89167867) has the molecular formula C32H38ClN9O5 and a molecular weight of 664.17 g/mol. Its IUPAC name is 1-[4-[(E)-pyrrolidin-1-yldiazenyl]oxybutanoyloxy]ethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 1-[4-[(E)-pyrrolidin-1-yldiazenyl]oxybutanoyloxy]ethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 89167867 |
| Molecular Formula | C32H38ClN9O5 |
| Molecular Weight | 664.17 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 1-[4-[(E)-pyrrolidin-1-yldiazenyl]oxybutanoyloxy]ethyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OC(C)OC(=O)CCCO/N=N/N2CCCC2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H38ClN9O5/c1-3-4-12-27-34-30(33)29(32(44)47-22(2)46-28(43)13-9-20-45-40-39-41-18-7-8-19-41)42(27)21-23-14-16-24(17-15-23)25-10-5-6-11-26(25)31-35-37-38-36-31/h5-6,10-11,14-17,22H,3-4,7-9,12-13,18-21H2,1-2H3,(H,35,36,37,38)/b40-39+ |
| InChIKey | VEZUGCIACGZUNL-XQQUEIPISA-N |
| XLogP | 6.00 |
| TPSA | 162.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.17 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|