C31H31ClN6O4 — CID 57402292
3-(3,4-dihydroxyphenyl)propyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 57402292) has the molecular formula C31H31ClN6O4 and a molecular weight of 587.08 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)propyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 3-(3,4-dihydroxyphenyl)propyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 57402292 |
| Molecular Formula | C31H31ClN6O4 |
| Molecular Weight | 587.08 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)propyl 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OCCCc2ccc(O)c(O)c2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H31ClN6O4/c1-2-3-10-27-33-29(32)28(31(41)42-17-6-7-20-13-16-25(39)26(40)18-20)38(27)19-21-11-14-22(15-12-21)23-8-4-5-9-24(23)30-34-36-37-35-30/h4-5,8-9,11-16,18,39-40H,2-3,6-7,10,17,19H2,1H3,(H,34,35,36,37) |
| InChIKey | HIYSQFVPTZPXMO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.08 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|