C25H28ClN7O5 — CID 89302009
[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 3-(dihydroxyamino)oxypropanoate (PubChem CID 89302009) has the molecular formula C25H28ClN7O5 and a molecular weight of 542.00 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 3-(dihydroxyamino)oxypropanoate.
| Compound Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 3-(dihydroxyamino)oxypropanoate |
|---|---|
| PubChem CID | 89302009 |
| Molecular Formula | C25H28ClN7O5 |
| Molecular Weight | 542.00 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 3-(dihydroxyamino)oxypropanoate |
| SMILES | CCCCc1nc(Cl)c(COC(=O)CCON(O)O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H28ClN7O5/c1-2-3-8-22-27-24(26)21(16-37-23(34)13-14-38-33(35)36)32(22)15-17-9-11-18(12-10-17)19-6-4-5-7-20(19)25-28-30-31-29-25/h4-7,9-12,35-36H,2-3,8,13-16H2,1H3,(H,28,29,30,31) |
| InChIKey | WLAATXZVEDMQRI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.00 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|