C25H28ClN7O6 — CID 89302464
[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 1-(dihydroxyamino)oxyethyl carbonate (PubChem CID 89302464) has the molecular formula C25H28ClN7O6 and a molecular weight of 558.00 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 1-(dihydroxyamino)oxyethyl carbonate.
| Compound Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 1-(dihydroxyamino)oxyethyl carbonate |
|---|---|
| PubChem CID | 89302464 |
| Molecular Formula | C25H28ClN7O6 |
| Molecular Weight | 558.00 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl 1-(dihydroxyamino)oxyethyl carbonate |
| SMILES | CCCCc1nc(Cl)c(COC(=O)OC(C)ON(O)O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H28ClN7O6/c1-3-4-9-22-27-23(26)21(15-37-25(34)38-16(2)39-33(35)36)32(22)14-17-10-12-18(13-11-17)19-7-5-6-8-20(19)24-28-30-31-29-24/h5-8,10-13,16,35-36H,3-4,9,14-15H2,1-2H3,(H,28,29,30,31) |
| InChIKey | HTQCJMMZJYAFKY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 160.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.00 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|