C27H33ClN8O8 — CID 89264245
[(4R)-4,5-bis[(dihydroxyamino)oxy]pentyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 89264245) has the molecular formula C27H33ClN8O8 and a molecular weight of 633.06 g/mol. Its IUPAC name is [(4R)-4,5-bis[(dihydroxyamino)oxy]pentyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | [(4R)-4,5-bis[(dihydroxyamino)oxy]pentyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 89264245 |
| Molecular Formula | C27H33ClN8O8 |
| Molecular Weight | 633.06 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | [(4R)-4,5-bis[(dihydroxyamino)oxy]pentyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OCCC[C@H](CON(O)O)ON(O)O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H33ClN8O8/c1-2-3-10-23-29-25(28)24(27(37)42-15-6-7-20(44-36(40)41)17-43-35(38)39)34(23)16-18-11-13-19(14-12-18)21-8-4-5-9-22(21)26-30-32-33-31-26/h4-5,8-9,11-14,20,38-41H,2-3,6-7,10,15-17H2,1H3,(H,30,31,32,33)/t20-/m1/s1 |
| InChIKey | ZIZWIFBGYHNWOH-HXUWFJFHSA-N |
| XLogP | 4.10 |
| TPSA | 204.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.06 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|