C31H35ClN8O10 — CID 24962010
[(2R)-1-[(5S)-5,6-dinitrooxyhexoxy]-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 24962010) has the molecular formula C31H35ClN8O10 and a molecular weight of 715.12 g/mol. Its IUPAC name is [(2R)-1-[(5S)-5,6-dinitrooxyhexoxy]-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | [(2R)-1-[(5S)-5,6-dinitrooxyhexoxy]-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 24962010 |
| Molecular Formula | C31H35ClN8O10 |
| Molecular Weight | 715.12 g/mol |
| Exact Mass | 714.22 |
| IUPAC Name | [(2R)-1-[(5S)-5,6-dinitrooxyhexoxy]-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)O[C@H](C)C(=O)OCCCC[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H35ClN8O10/c1-3-4-12-26-33-28(32)27(31(42)49-20(2)30(41)47-17-8-7-9-23(50-40(45)46)19-48-39(43)44)38(26)18-21-13-15-22(16-14-21)24-10-5-6-11-25(24)29-34-36-37-35-29/h5-6,10-11,13-16,20,23H,3-4,7-9,12,17-19H2,1-2H3,(H,34,35,36,37)/t20-,23+/m1/s1 |
| InChIKey | AGQGUWBGBVRFQO-OFNKIYASSA-N |
| XLogP | 4.82 |
| TPSA | 229.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.12 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|