C26H29ClN8O4 — CID 142757068
4-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]butyl nitrate (PubChem CID 142757068) has the molecular formula C26H29ClN8O4 and a molecular weight of 553.02 g/mol. Its IUPAC name is 4-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]butyl nitrate.
| Compound Name | 4-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]butyl nitrate |
|---|---|
| PubChem CID | 142757068 |
| Molecular Formula | C26H29ClN8O4 |
| Molecular Weight | 553.02 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 4-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]butyl nitrate |
| SMILES | CCCCc1nc(Cl)c(C(=O)NCCCCO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C26H29ClN8O4/c1-2-3-10-22-29-24(27)23(26(36)28-15-6-7-16-39-35(37)38)34(22)17-18-11-13-19(14-12-18)20-8-4-5-9-21(20)25-30-32-33-31-25/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,28,36)(H,30,31,32,33) |
| InChIKey | KKDPAYAZNNBZEY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.02 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|