C31H37N7O7 — CID 58165004
4-nitrooxybutyl 4-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate (PubChem CID 58165004) has the molecular formula C31H37N7O7 and a molecular weight of 619.68 g/mol. Its IUPAC name is 4-nitrooxybutyl 4-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate.
| Compound Name | 4-nitrooxybutyl 4-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 58165004 |
| Molecular Formula | C31H37N7O7 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | 4-nitrooxybutyl 4-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)CCC(=O)OCCCCO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H37N7O7/c1-4-9-26-32-29(31(2,3)41)28(25(39)16-17-27(40)44-18-7-8-19-45-38(42)43)37(26)20-21-12-14-22(15-13-21)23-10-5-6-11-24(23)30-33-35-36-34-30/h5-6,10-15,41H,4,7-9,16-20H2,1-3H3,(H,33,34,35,36) |
| InChIKey | LZZNLMKLGXJKIJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 188.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|