C34H43ClN8O7 — CID 58165177
4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-(4-nitrooxybutyl) (2R)-2-(4-aminobutyl)butanedioate (PubChem CID 58165177) has the molecular formula C34H43ClN8O7 and a molecular weight of 711.22 g/mol. Its IUPAC name is 4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-(4-nitrooxybutyl) (2R)-2-(4-aminobutyl)butanedioate.
| Compound Name | 4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-(4-nitrooxybutyl) (2R)-2-(4-aminobutyl)butanedioate |
|---|---|
| PubChem CID | 58165177 |
| Molecular Formula | C34H43ClN8O7 |
| Molecular Weight | 711.22 g/mol |
| Exact Mass | 710.29 |
| IUPAC Name | 4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-(4-nitrooxybutyl) (2R)-2-(4-aminobutyl)butanedioate |
| SMILES | CCCCc1nc(Cl)c(COC(=O)C[C@@H](CCCCN)C(=O)OCCCCO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C34H43ClN8O7/c1-2-3-13-30-37-32(35)29(23-49-31(44)21-26(10-6-7-18-36)34(45)48-19-8-9-20-50-43(46)47)42(30)22-24-14-16-25(17-15-24)27-11-4-5-12-28(27)33-38-40-41-39-33/h4-5,11-12,14-17,26H,2-3,6-10,13,18-23,36H2,1H3,(H,38,39,40,41)/t26-/m1/s1 |
| InChIKey | IONGHNNDAORZPI-AREMUKBSSA-N |
| XLogP | 5.48 |
| TPSA | 203.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.22 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|