C40H38ClN7O7 — CID 58165109
4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-[3-(nitrooxymethyl)phenyl] 2-benzylbutanedioate (PubChem CID 58165109) has the molecular formula C40H38ClN7O7 and a molecular weight of 764.24 g/mol. Its IUPAC name is 4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-[3-(nitrooxymethyl)phenyl] 2-benzylbutanedioate.
| Compound Name | 4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-[3-(nitrooxymethyl)phenyl] 2-benzylbutanedioate |
|---|---|
| PubChem CID | 58165109 |
| Molecular Formula | C40H38ClN7O7 |
| Molecular Weight | 764.24 g/mol |
| Exact Mass | 763.25 |
| IUPAC Name | 4-O-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl] 1-O-[3-(nitrooxymethyl)phenyl] 2-benzylbutanedioate |
| SMILES | CCCCc1nc(Cl)c(COC(=O)CC(Cc2ccccc2)C(=O)Oc2cccc(CO[N+](=O)[O-])c2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C40H38ClN7O7/c1-2-3-16-36-42-38(41)35(47(36)24-28-17-19-30(20-18-28)33-14-7-8-15-34(33)39-43-45-46-44-39)26-53-37(49)23-31(21-27-10-5-4-6-11-27)40(50)55-32-13-9-12-29(22-32)25-54-48(51)52/h4-15,17-20,22,31H,2-3,16,21,23-26H2,1H3,(H,43,44,45,46) |
| InChIKey | FZTNSZNKFMRVIN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.24 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|