C32H31ClN8O6 — CID 68642033
2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-3-[4-(nitrooxymethyl)phenyl]propanoic acid (PubChem CID 68642033) has the molecular formula C32H31ClN8O6 and a molecular weight of 659.10 g/mol. Its IUPAC name is 2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-3-[4-(nitrooxymethyl)phenyl]propanoic acid.
| Compound Name | 2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-3-[4-(nitrooxymethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 68642033 |
| Molecular Formula | C32H31ClN8O6 |
| Molecular Weight | 659.10 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | 2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-3-[4-(nitrooxymethyl)phenyl]propanoic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)NC(Cc2ccc(CO[N+](=O)[O-])cc2)C(=O)O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H31ClN8O6/c1-2-3-8-27-35-29(33)28(31(42)34-26(32(43)44)17-20-9-11-22(12-10-20)19-47-41(45)46)40(27)18-21-13-15-23(16-14-21)24-6-4-5-7-25(24)30-36-38-39-37-30/h4-7,9-16,26H,2-3,8,17-19H2,1H3,(H,34,42)(H,43,44)(H,36,37,38,39) |
| InChIKey | TVJKZHVMVZMQSK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.10 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|