C30H36ClN7O5 — CID 59370640
[(6S)-6-methyl-7-nitrooxyheptyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 59370640) has the molecular formula C30H36ClN7O5 and a molecular weight of 610.12 g/mol. Its IUPAC name is [(6S)-6-methyl-7-nitrooxyheptyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | [(6S)-6-methyl-7-nitrooxyheptyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 59370640 |
| Molecular Formula | C30H36ClN7O5 |
| Molecular Weight | 610.12 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | [(6S)-6-methyl-7-nitrooxyheptyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OCCCCC[C@H](C)CO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C30H36ClN7O5/c1-3-4-13-26-32-28(31)27(30(39)42-18-9-5-6-10-21(2)20-43-38(40)41)37(26)19-22-14-16-23(17-15-22)24-11-7-8-12-25(24)29-33-35-36-34-29/h7-8,11-12,14-17,21H,3-6,9-10,13,18-20H2,1-2H3,(H,33,34,35,36)/t21-/m0/s1 |
| InChIKey | NSQMKJGXRALJAW-NRFANRHFSA-N |
| XLogP | 6.34 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.12 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|