C32H37ClN8O10 — CID 24960915
(5,7-dinitrooxy-1-propanoyloxyheptyl) 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 24960915) has the molecular formula C32H37ClN8O10 and a molecular weight of 729.15 g/mol. Its IUPAC name is (5,7-dinitrooxy-1-propanoyloxyheptyl) 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | (5,7-dinitrooxy-1-propanoyloxyheptyl) 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 24960915 |
| Molecular Formula | C32H37ClN8O10 |
| Molecular Weight | 729.15 g/mol |
| Exact Mass | 728.23 |
| IUPAC Name | (5,7-dinitrooxy-1-propanoyloxyheptyl) 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OC(CCCC(CCO[N+](=O)[O-])O[N+](=O)[O-])OC(=O)CC)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H37ClN8O10/c1-3-5-12-26-34-30(33)29(32(43)50-28(49-27(42)4-2)13-8-9-23(51-41(46)47)18-19-48-40(44)45)39(26)20-21-14-16-22(17-15-21)24-10-6-7-11-25(24)31-35-37-38-36-31/h6-7,10-11,14-17,23,28H,3-5,8-9,12-13,18-20H2,1-2H3,(H,35,36,37,38) |
| InChIKey | GPVICLNCICEOGX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 229.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.15 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|