C29H26ClN7O5 — CID 11490198
[2-(nitrooxymethyl)phenyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 11490198) has the molecular formula C29H26ClN7O5 and a molecular weight of 588.02 g/mol. Its IUPAC name is [2-(nitrooxymethyl)phenyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | [2-(nitrooxymethyl)phenyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 11490198 |
| Molecular Formula | C29H26ClN7O5 |
| Molecular Weight | 588.02 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | [2-(nitrooxymethyl)phenyl] 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)Oc2ccccc2CO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C29H26ClN7O5/c1-2-3-12-25-31-27(30)26(29(38)42-24-11-7-4-8-21(24)18-41-37(39)40)36(25)17-19-13-15-20(16-14-19)22-9-5-6-10-23(22)28-32-34-35-33-28/h4-11,13-16H,2-3,12,17-18H2,1H3,(H,32,33,34,35) |
| InChIKey | UPBPITPSLBUHQE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.02 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|