C32H33N7O6 — CID 11227297
[2-(nitrooxymethyl)phenyl]methyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 11227297) has the molecular formula C32H33N7O6 and a molecular weight of 611.66 g/mol. Its IUPAC name is [2-(nitrooxymethyl)phenyl]methyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | [2-(nitrooxymethyl)phenyl]methyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 11227297 |
| Molecular Formula | C32H33N7O6 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | [2-(nitrooxymethyl)phenyl]methyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)OCc2ccccc2CO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H33N7O6/c1-4-9-27-33-29(32(2,3)41)28(31(40)44-19-23-10-5-6-11-24(23)20-45-39(42)43)38(27)18-21-14-16-22(17-15-21)25-12-7-8-13-26(25)30-34-36-37-35-30/h5-8,10-17,41H,4,9,18-20H2,1-3H3,(H,34,35,36,37) |
| InChIKey | SEXCNYZOMIFFRN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 171.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|