C38H48N8O12 — CID 58165158
bis(4-nitrooxybutyl) 2-[2-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-oxoethyl]pentanedioate (PubChem CID 58165158) has the molecular formula C38H48N8O12 and a molecular weight of 808.85 g/mol. Its IUPAC name is bis(4-nitrooxybutyl) 2-[2-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-oxoethyl]pentanedioate.
| Compound Name | bis(4-nitrooxybutyl) 2-[2-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-oxoethyl]pentanedioate |
|---|---|
| PubChem CID | 58165158 |
| Molecular Formula | C38H48N8O12 |
| Molecular Weight | 808.85 g/mol |
| Exact Mass | 808.34 |
| IUPAC Name | bis(4-nitrooxybutyl) 2-[2-[5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-oxoethyl]pentanedioate |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)CC(CCC(=O)OCCCCO[N+](=O)[O-])C(=O)OCCCCO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C38H48N8O12/c1-4-11-32-39-35(38(2,3)50)34(44(32)25-26-14-16-27(17-15-26)29-12-5-6-13-30(29)36-40-42-43-41-36)31(47)24-28(37(49)56-21-8-10-23-58-46(53)54)18-19-33(48)55-20-7-9-22-57-45(51)52/h5-6,12-17,28,50H,4,7-11,18-25H2,1-3H3,(H,40,41,42,43) |
| InChIKey | QEHLUUWHXGGXHD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 266.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.85 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|