C28H33N7O6S — CID 11330829
2-(2-nitrooxyethylsulfanyl)ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 11330829) has the molecular formula C28H33N7O6S and a molecular weight of 595.68 g/mol. Its IUPAC name is 2-(2-nitrooxyethylsulfanyl)ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 2-(2-nitrooxyethylsulfanyl)ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 11330829 |
| Molecular Formula | C28H33N7O6S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 2-(2-nitrooxyethylsulfanyl)ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)OCCSCCO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H33N7O6S/c1-4-7-23-29-25(28(2,3)37)24(27(36)40-14-16-42-17-15-41-35(38)39)34(23)18-19-10-12-20(13-11-19)21-8-5-6-9-22(21)26-30-32-33-31-26/h5-6,8-13,37H,4,7,14-18H2,1-3H3,(H,30,31,32,33) |
| InChIKey | UKXOBGYHRGTLIV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 171.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|