C36H38ClN7O6 — CID 58165035
4-nitrooxybutyl 2-benzyl-4-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate (PubChem CID 58165035) has the molecular formula C36H38ClN7O6 and a molecular weight of 700.20 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-benzyl-4-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate.
| Compound Name | 4-nitrooxybutyl 2-benzyl-4-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 58165035 |
| Molecular Formula | C36H38ClN7O6 |
| Molecular Weight | 700.20 g/mol |
| Exact Mass | 699.26 |
| IUPAC Name | 4-nitrooxybutyl 2-benzyl-4-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-4-oxobutanoate |
| SMILES | CCCCc1nc(Cl)c(C(=O)CC(Cc2ccccc2)C(=O)OCCCCO[N+](=O)[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C36H38ClN7O6/c1-2-3-15-32-38-34(37)33(31(45)23-28(22-25-11-5-4-6-12-25)36(46)49-20-9-10-21-50-44(47)48)43(32)24-26-16-18-27(19-17-26)29-13-7-8-14-30(29)35-39-41-42-40-35/h4-8,11-14,16-19,28H,2-3,9-10,15,20-24H2,1H3,(H,39,40,41,42) |
| InChIKey | CFTHLBAIOMZSPR-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 168.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.20 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|