C33H41ClN8O7 — CID 143854145
[(2S)-2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methoxycarbonylamino]-4-methylpentyl] 4-nitrooxybutanoate (PubChem CID 143854145) has the molecular formula C33H41ClN8O7 and a molecular weight of 697.19 g/mol. Its IUPAC name is [(2S)-2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methoxycarbonylamino]-4-methylpentyl] 4-nitrooxybutanoate.
| Compound Name | [(2S)-2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methoxycarbonylamino]-4-methylpentyl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 143854145 |
| Molecular Formula | C33H41ClN8O7 |
| Molecular Weight | 697.19 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | [(2S)-2-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methoxycarbonylamino]-4-methylpentyl] 4-nitrooxybutanoate |
| SMILES | CCCCc1nc(Cl)c(COC(=O)N[C@H](COC(=O)CCCO[N+](=O)[O-])CC(C)C)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H41ClN8O7/c1-4-5-11-29-36-31(34)28(21-48-33(44)35-25(18-22(2)3)20-47-30(43)12-8-17-49-42(45)46)41(29)19-23-13-15-24(16-14-23)26-9-6-7-10-27(26)32-37-39-40-38-32/h6-7,9-10,13-16,22,25H,4-5,8,11-12,17-21H2,1-3H3,(H,35,44)(H,37,38,39,40)/t25-/m0/s1 |
| InChIKey | OKNIKWLBTKDTRH-VWLOTQADSA-N |
| XLogP | 5.95 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.19 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|