C31H40ClN9O10 — CID 143854175
2-[[2-butyl-5-chloro-3-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]ethyl 5,6-dinitrooxyhexyl carbonate (PubChem CID 143854175) has the molecular formula C31H40ClN9O10 and a molecular weight of 734.17 g/mol. Its IUPAC name is 2-[[2-butyl-5-chloro-3-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]ethyl 5,6-dinitrooxyhexyl carbonate.
| Compound Name | 2-[[2-butyl-5-chloro-3-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]ethyl 5,6-dinitrooxyhexyl carbonate |
|---|---|
| PubChem CID | 143854175 |
| Molecular Formula | C31H40ClN9O10 |
| Molecular Weight | 734.17 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | 2-[[2-butyl-5-chloro-3-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]ethyl 5,6-dinitrooxyhexyl carbonate |
| SMILES | CCCCc1nc(Cl)c(C(=O)NCCOC(=O)OCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])n1Cc1ccc(-c2ccccc2/C(N)=N/NN)cc1 |
| InChI | InChI=1S/C31H40ClN9O10/c1-2-3-11-26-36-28(32)27(39(26)19-21-12-14-22(15-13-21)24-9-4-5-10-25(24)29(33)37-38-34)30(42)35-16-18-49-31(43)48-17-7-6-8-23(51-41(46)47)20-50-40(44)45/h4-5,9-10,12-15,23,38H,2-3,6-8,11,16-20,34H2,1H3,(H2,33,37)(H,35,42) |
| InChIKey | LMZCEUSXDCBBFO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 263.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|