C22H24ClN5O2 — CID 143701483
3-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid (PubChem CID 143701483) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 3-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid.
| Compound Name | 3-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 143701483 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc(-c2ccccc2/C(N)=N/N)cc1 |
| InChI | InChI=1S/C22H24ClN5O2/c1-2-3-8-18-26-20(23)19(22(29)30)28(18)13-14-9-11-15(12-10-14)16-6-4-5-7-17(16)21(24)27-25/h4-7,9-12H,2-3,8,13,25H2,1H3,(H2,24,27)(H,29,30) |
| InChIKey | RFVURBUHHZLRNU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|