C27H32ClN7O8 — CID 143266487
3-[[4-[2-[(Z)-N'-[amino-[2-(2-nitrooxyethoxy)ethoxycarbonyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid (PubChem CID 143266487) has the molecular formula C27H32ClN7O8 and a molecular weight of 618.05 g/mol. Its IUPAC name is 3-[[4-[2-[(Z)-N'-[amino-[2-(2-nitrooxyethoxy)ethoxycarbonyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid.
| Compound Name | 3-[[4-[2-[(Z)-N'-[amino-[2-(2-nitrooxyethoxy)ethoxycarbonyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 143266487 |
| Molecular Formula | C27H32ClN7O8 |
| Molecular Weight | 618.05 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 3-[[4-[2-[(Z)-N'-[amino-[2-(2-nitrooxyethoxy)ethoxycarbonyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc(-c2ccccc2/C(N)=N/N(N)C(=O)OCCOCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H32ClN7O8/c1-2-3-8-22-31-24(28)23(26(36)37)33(22)17-18-9-11-19(12-10-18)20-6-4-5-7-21(20)25(29)32-34(30)27(38)42-15-13-41-14-16-43-35(39)40/h4-7,9-12H,2-3,8,13-17,30H2,1H3,(H2,29,32)(H,36,37) |
| InChIKey | UOLCSZLDOQQNSM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 210.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.05 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|