C29H32ClN7O8S — CID 143266565
2-butyl-5-chloro-3-[[4-[2-[2-[1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 143266565) has the molecular formula C29H32ClN7O8S and a molecular weight of 674.14 g/mol. Its IUPAC name is 2-butyl-5-chloro-3-[[4-[2-[2-[1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 2-butyl-5-chloro-3-[[4-[2-[2-[1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 143266565 |
| Molecular Formula | C29H32ClN7O8S |
| Molecular Weight | 674.14 g/mol |
| Exact Mass | 673.17 |
| IUPAC Name | 2-butyl-5-chloro-3-[[4-[2-[2-[1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nnn(C(C)OC(=O)OCCSCCO[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C29H32ClN7O8S/c1-3-4-9-24-31-26(30)25(28(38)39)35(24)18-20-10-12-21(13-11-20)22-7-5-6-8-23(22)27-32-34-36(33-27)19(2)45-29(40)43-14-16-46-17-15-44-37(41)42/h5-8,10-13,19H,3-4,9,14-18H2,1-2H3,(H,38,39) |
| InChIKey | NJUBJGGCYBLSLG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 186.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.14 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|