C33H32ClN7O8 — CID 143266350
2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 143266350) has the molecular formula C33H32ClN7O8 and a molecular weight of 690.11 g/mol. Its IUPAC name is 2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 143266350 |
| Molecular Formula | C33H32ClN7O8 |
| Molecular Weight | 690.11 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | 2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nnn(C(C)OC(=O)OCc3ccccc3CO[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C33H32ClN7O8/c1-3-4-13-28-35-30(34)29(32(42)43)39(28)18-22-14-16-23(17-15-22)26-11-7-8-12-27(26)31-36-38-40(37-31)21(2)49-33(44)47-19-24-9-5-6-10-25(24)20-48-41(45)46/h5-12,14-17,21H,3-4,13,18-20H2,1-2H3,(H,42,43) |
| InChIKey | QMKDGQXULCWPHP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 186.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.11 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|