C28H32ClN7O8 — CID 70324859
2-butyl-5-chloro-3-[[4-[2-[2-[1-[3-(dihydroxyamino)oxypropoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 70324859) has the molecular formula C28H32ClN7O8 and a molecular weight of 630.06 g/mol. Its IUPAC name is 2-butyl-5-chloro-3-[[4-[2-[2-[1-[3-(dihydroxyamino)oxypropoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 2-butyl-5-chloro-3-[[4-[2-[2-[1-[3-(dihydroxyamino)oxypropoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70324859 |
| Molecular Formula | C28H32ClN7O8 |
| Molecular Weight | 630.06 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | 2-butyl-5-chloro-3-[[4-[2-[2-[1-[3-(dihydroxyamino)oxypropoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nnn(C(C)OC(=O)OCCCON(O)O)n2)cc1 |
| InChI | InChI=1S/C28H32ClN7O8/c1-3-4-10-23-30-25(29)24(27(37)38)34(23)17-19-11-13-20(14-12-19)21-8-5-6-9-22(21)26-31-33-35(32-26)18(2)44-28(39)42-15-7-16-43-36(40)41/h5-6,8-9,11-14,18,40-41H,3-4,7,10,15-17H2,1-2H3,(H,37,38) |
| InChIKey | VZBGJIWPKPZMLT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.06 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|