C31H33N7O10 — CID 70324306
3-[[4-[2-[2-[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid (PubChem CID 70324306) has the molecular formula C31H33N7O10 and a molecular weight of 663.64 g/mol. Its IUPAC name is 3-[[4-[2-[2-[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid.
| Compound Name | 3-[[4-[2-[2-[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70324306 |
| Molecular Formula | C31H33N7O10 |
| Molecular Weight | 663.64 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | 3-[[4-[2-[2-[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid |
| SMILES | CCOc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2nnn(C(C)OC(=O)OCCOCCON(O)O)n2)cc1 |
| InChI | InChI=1S/C31H33N7O10/c1-3-45-30-32-26-10-6-9-25(29(39)40)27(26)36(30)19-21-11-13-22(14-12-21)23-7-4-5-8-24(23)28-33-35-37(34-28)20(2)48-31(41)46-17-15-44-16-18-47-38(42)43/h4-14,20,42-43H,3,15-19H2,1-2H3,(H,39,40) |
| InChIKey | XJBPDMPPMAISNA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 205.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|