C34H39N7O9 — CID 89005847
2-[5-(dihydroxyamino)oxyhexoxycarbonyloxy]propan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 89005847) has the molecular formula C34H39N7O9 and a molecular weight of 689.73 g/mol. Its IUPAC name is 2-[5-(dihydroxyamino)oxyhexoxycarbonyloxy]propan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | 2-[5-(dihydroxyamino)oxyhexoxycarbonyloxy]propan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 89005847 |
| Molecular Formula | C34H39N7O9 |
| Molecular Weight | 689.73 g/mol |
| Exact Mass | 689.28 |
| IUPAC Name | 2-[5-(dihydroxyamino)oxyhexoxycarbonyloxy]propan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)(C)OC(=O)OCCCCC(C)ON(O)O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C34H39N7O9/c1-5-46-32-35-28-15-10-14-27(31(42)48-34(3,4)49-33(43)47-20-9-8-11-22(2)50-41(44)45)29(28)40(32)21-23-16-18-24(19-17-23)25-12-6-7-13-26(25)30-36-38-39-37-30/h6-7,10,12-19,22,44-45H,5,8-9,11,20-21H2,1-4H3,(H,36,37,38,39) |
| InChIKey | VLBFLJRIWMQTOR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 196.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|