C35H38N8O12 — CID 59549896
2-[(4R,5S)-3-methyl-4,5-dinitrooxyhexoxy]carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 59549896) has the molecular formula C35H38N8O12 and a molecular weight of 762.73 g/mol. Its IUPAC name is 2-[(4R,5S)-3-methyl-4,5-dinitrooxyhexoxy]carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | 2-[(4R,5S)-3-methyl-4,5-dinitrooxyhexoxy]carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 59549896 |
| Molecular Formula | C35H38N8O12 |
| Molecular Weight | 762.73 g/mol |
| Exact Mass | 762.26 |
| IUPAC Name | 2-[(4R,5S)-3-methyl-4,5-dinitrooxyhexoxy]carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)(C)OC(=O)OCCC(C)[C@@H](O[N+](=O)[O-])[C@H](C)O[N+](=O)[O-])c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C35H38N8O12/c1-6-50-33-36-28-13-9-12-27(29(28)41(33)20-23-14-16-24(17-15-23)25-10-7-8-11-26(25)31-37-39-40-38-31)32(44)52-35(4,5)53-34(45)51-19-18-21(2)30(55-43(48)49)22(3)54-42(46)47/h7-17,21-22,30H,6,18-20H2,1-5H3,(H,37,38,39,40)/t21?,22-,30+/m0/s1 |
| InChIKey | NXIYTZFDNMSAHB-XAVQGRBISA-N |
| XLogP | 5.58 |
| TPSA | 248.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|