C32H32N8O11 — CID 24962376
1-[(5S)-5,6-dinitrooxyhexanoyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 24962376) has the molecular formula C32H32N8O11 and a molecular weight of 704.65 g/mol. Its IUPAC name is 1-[(5S)-5,6-dinitrooxyhexanoyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | 1-[(5S)-5,6-dinitrooxyhexanoyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 24962376 |
| Molecular Formula | C32H32N8O11 |
| Molecular Weight | 704.65 g/mol |
| Exact Mass | 704.22 |
| IUPAC Name | 1-[(5S)-5,6-dinitrooxyhexanoyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)OC(=O)CCC[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-])c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H32N8O11/c1-3-47-32-33-27-12-7-11-26(31(42)50-20(2)49-28(41)13-6-8-23(51-40(45)46)19-48-39(43)44)29(27)38(32)18-21-14-16-22(17-15-21)24-9-4-5-10-25(24)30-34-36-37-35-30/h4-5,7,9-12,14-17,20,23H,3,6,8,13,18-19H2,1-2H3,(H,34,35,36,37)/t20?,23-/m0/s1 |
| InChIKey | FKIAZAPZSSQAIH-AKRCKQFNSA-N |
| XLogP | 4.33 |
| TPSA | 238.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|