C28H26N6O5 — CID 14962911
propanoyloxymethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 14962911) has the molecular formula C28H26N6O5 and a molecular weight of 526.55 g/mol. Its IUPAC name is propanoyloxymethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | propanoyloxymethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 14962911 |
| Molecular Formula | C28H26N6O5 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | propanoyloxymethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OCOC(=O)CC)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H26N6O5/c1-3-24(35)38-17-39-27(36)22-10-7-11-23-25(22)34(28(29-23)37-4-2)16-18-12-14-19(15-13-18)20-8-5-6-9-21(20)26-30-32-33-31-26/h5-15H,3-4,16-17H2,1-2H3,(H,30,31,32,33) |
| InChIKey | LHOCWVFNTNDYBW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|