C26H24N6O2 — CID 15654719
ethyl 2-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 15654719) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is ethyl 2-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | ethyl 2-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 15654719 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | ethyl 2-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cccc2nc(CC)n(Cc3ccc(-c4ccccc4-c4nn[nH]n4)cc3)c12 |
| InChI | InChI=1S/C26H24N6O2/c1-3-23-27-22-11-7-10-21(26(33)34-4-2)24(22)32(23)16-17-12-14-18(15-13-17)19-8-5-6-9-20(19)25-28-30-31-29-25/h5-15H,3-4,16H2,1-2H3,(H,28,29,30,31) |
| InChIKey | RWCUCBGHAZTHIR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |