C32H27N7O6 — CID 11307973
[4-(nitrooxymethyl)phenyl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 11307973) has the molecular formula C32H27N7O6 and a molecular weight of 605.61 g/mol. Its IUPAC name is [4-(nitrooxymethyl)phenyl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | [4-(nitrooxymethyl)phenyl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 11307973 |
| Molecular Formula | C32H27N7O6 |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | [4-(nitrooxymethyl)phenyl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OCc3ccc(CO[N+](=O)[O-])cc3)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H27N7O6/c1-2-43-32-33-28-9-5-8-27(31(40)44-19-22-10-12-23(13-11-22)20-45-39(41)42)29(28)38(32)18-21-14-16-24(17-15-21)25-6-3-4-7-26(25)30-34-36-37-35-30/h3-17H,2,18-20H2,1H3,(H,34,35,36,37) |
| InChIKey | MBMHDTFNSXFOQE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 160.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|