C34H29N7O9 — CID 11365931
1-[2-(nitrooxymethyl)phenoxy]carbonyloxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 11365931) has the molecular formula C34H29N7O9 and a molecular weight of 679.65 g/mol. Its IUPAC name is 1-[2-(nitrooxymethyl)phenoxy]carbonyloxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | 1-[2-(nitrooxymethyl)phenoxy]carbonyloxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 11365931 |
| Molecular Formula | C34H29N7O9 |
| Molecular Weight | 679.65 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | 1-[2-(nitrooxymethyl)phenoxy]carbonyloxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)OC(=O)Oc3ccccc3CO[N+](=O)[O-])c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C34H29N7O9/c1-3-46-33-35-28-13-8-12-27(32(42)48-21(2)49-34(43)50-29-14-7-4-9-24(29)20-47-41(44)45)30(28)40(33)19-22-15-17-23(18-16-22)25-10-5-6-11-26(25)31-36-38-39-37-31/h4-18,21H,3,19-20H2,1-2H3,(H,36,37,38,39) |
| InChIKey | LSONNLZTTXJSNT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 195.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|