C34H38N9O8+ — CID 89167860
[3-[1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]oxyethoxycarbonyloxy]propoxyamino]-oxo-pyrrolidin-1-ylazanium (PubChem CID 89167860) has the molecular formula C34H38N9O8+ and a molecular weight of 700.73 g/mol. Its IUPAC name is [3-[1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]oxyethoxycarbonyloxy]propoxyamino]-oxo-pyrrolidin-1-ylazanium.
| Compound Name | [3-[1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]oxyethoxycarbonyloxy]propoxyamino]-oxo-pyrrolidin-1-ylazanium |
|---|---|
| PubChem CID | 89167860 |
| Molecular Formula | C34H38N9O8+ |
| Molecular Weight | 700.73 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | [3-[1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]oxyethoxycarbonyloxy]propoxyamino]-oxo-pyrrolidin-1-ylazanium |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)OC(=O)OCCCON[N+](=O)N3CCCC3)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C34H38N9O8/c1-3-47-33-35-29-13-8-12-28(32(44)50-23(2)51-34(45)48-20-9-21-49-40-43(46)41-18-6-7-19-41)30(29)42(33)22-24-14-16-25(17-15-24)26-10-4-5-11-27(26)31-36-38-39-37-31/h4-5,8,10-17,23H,3,6-7,9,18-22H2,1-2H3,(H,40,46)(H,36,37,38,39)/q+1 |
| InChIKey | IUTNFSNCEGWLOE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|