C33H33N7O9 — CID 46209428
1-[(1R,3S,4S)-3-methoxy-4-nitrooxycyclopentanecarbonyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 46209428) has the molecular formula C33H33N7O9 and a molecular weight of 671.67 g/mol. Its IUPAC name is 1-[(1R,3S,4S)-3-methoxy-4-nitrooxycyclopentanecarbonyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | 1-[(1R,3S,4S)-3-methoxy-4-nitrooxycyclopentanecarbonyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 46209428 |
| Molecular Formula | C33H33N7O9 |
| Molecular Weight | 671.67 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | 1-[(1R,3S,4S)-3-methoxy-4-nitrooxycyclopentanecarbonyl]oxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)OC(=O)[C@@H]3C[C@H](OC)[C@@H](O[N+](=O)[O-])C3)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H33N7O9/c1-4-46-33-34-26-11-7-10-25(32(42)48-19(2)47-31(41)22-16-27(45-3)28(17-22)49-40(43)44)29(26)39(33)18-20-12-14-21(15-13-20)23-8-5-6-9-24(23)30-35-37-38-36-30/h5-15,19,22,27-28H,4,16-18H2,1-3H3,(H,35,36,37,38)/t19?,22-,27+,28+/m1/s1 |
| InChIKey | HZXKIQQNZKYEIV-ISFPMRQPSA-N |
| XLogP | 4.38 |
| TPSA | 195.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|