C32H32N6O7 — CID 24797478
1-(oxan-3-yloxycarbonyloxy)ethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 24797478) has the molecular formula C32H32N6O7 and a molecular weight of 612.64 g/mol. Its IUPAC name is 1-(oxan-3-yloxycarbonyloxy)ethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | 1-(oxan-3-yloxycarbonyloxy)ethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 24797478 |
| Molecular Formula | C32H32N6O7 |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 1-(oxan-3-yloxycarbonyloxy)ethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)OC(=O)OC3CCCOC3)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H32N6O7/c1-3-42-31-33-27-12-6-11-26(30(39)43-20(2)44-32(40)45-23-8-7-17-41-19-23)28(27)38(31)18-21-13-15-22(16-14-21)24-9-4-5-10-25(24)29-34-36-37-35-29/h4-6,9-16,20,23H,3,7-8,17-19H2,1-2H3,(H,34,35,36,37) |
| InChIKey | FNIGVBORVFXORE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 152.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|