C42H46N6O6 — CID 159735340
1-cyclohexyloxycarbonyloxyethyl 3-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;ethane (PubChem CID 159735340) has the molecular formula C42H46N6O6 and a molecular weight of 730.87 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 3-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;ethane.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;ethane |
|---|---|
| PubChem CID | 159735340 |
| Molecular Formula | C42H46N6O6 |
| Molecular Weight | 730.87 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;ethane |
| SMILES | CC.CCOc1nc2cccc(C(=O)OC(C)OC(=O)OC3CCCCC3)c2n1Cc1ccc(-c2ccccc2-c2nnnn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C40H40N6O6.C2H6/c1-3-49-39-41-35-20-12-19-34(38(47)50-27(2)51-40(48)52-31-15-8-5-9-16-31)36(35)45(39)25-29-21-23-30(24-22-29)32-17-10-11-18-33(32)37-42-43-44-46(37)26-28-13-6-4-7-14-28;1-2/h4,6-7,10-14,17-24,27,31H,3,5,8-9,15-16,25-26H2,1-2H3;1-2H3 |
| InChIKey | NBTOVOGSPIWWML-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 132.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.87 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|