C24H20N6O2 — CID 87687791
2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbaldehyde (PubChem CID 87687791) has the molecular formula C24H20N6O2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbaldehyde.
| Compound Name | 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 87687791 |
| Molecular Formula | C24H20N6O2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbaldehyde |
| SMILES | CCOc1nc2cccc(C=O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C24H20N6O2/c1-2-32-24-25-21-9-5-6-18(15-31)22(21)30(24)14-16-10-12-17(13-11-16)19-7-3-4-8-20(19)23-26-28-29-27-23/h3-13,15H,2,14H2,1H3,(H,26,27,28,29) |
| InChIKey | PHUZYSZOPTWKOF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|