C34H40N8O12 — CID 143701421
2-(5,6-dinitrooxyhexoxycarbonyloxy)propan-2-yl 3-[[4-[2-[(Z)-N-aminocarbamohydrazonoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate (PubChem CID 143701421) has the molecular formula C34H40N8O12 and a molecular weight of 752.74 g/mol. Its IUPAC name is 2-(5,6-dinitrooxyhexoxycarbonyloxy)propan-2-yl 3-[[4-[2-[(Z)-N-aminocarbamohydrazonoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate.
| Compound Name | 2-(5,6-dinitrooxyhexoxycarbonyloxy)propan-2-yl 3-[[4-[2-[(Z)-N-aminocarbamohydrazonoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 143701421 |
| Molecular Formula | C34H40N8O12 |
| Molecular Weight | 752.74 g/mol |
| Exact Mass | 752.28 |
| IUPAC Name | 2-(5,6-dinitrooxyhexoxycarbonyloxy)propan-2-yl 3-[[4-[2-[(Z)-N-aminocarbamohydrazonoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)(C)OC(=O)OCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])c2n1Cc1ccc(-c2ccccc2/C(=N/N)NN)cc1 |
| InChI | InChI=1S/C34H40N8O12/c1-4-49-32-37-28-14-9-13-27(29(28)40(32)20-22-15-17-23(18-16-22)25-11-5-6-12-26(25)30(38-35)39-36)31(43)52-34(2,3)53-33(44)50-19-8-7-10-24(54-42(47)48)21-51-41(45)46/h5-6,9,11-18,24H,4,7-8,10,19-21,35-36H2,1-3H3,(H,38,39) |
| InChIKey | WDERBKIGEAPPAF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 270.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|