C53H44N7O8+ — CID 59614878
2-(4-nitrophenoxy)carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(1-trityl-2H-tetrazol-1-ium-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 59614878) has the molecular formula C53H44N7O8+ and a molecular weight of 906.98 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(1-trityl-2H-tetrazol-1-ium-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | 2-(4-nitrophenoxy)carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(1-trityl-2H-tetrazol-1-ium-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 59614878 |
| Molecular Formula | C53H44N7O8+ |
| Molecular Weight | 906.98 g/mol |
| Exact Mass | 906.32 |
| IUPAC Name | 2-(4-nitrophenoxy)carbonyloxypropan-2-yl 2-ethoxy-3-[[4-[2-(1-trityl-2H-tetrazol-1-ium-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)(C)OC(=O)Oc3ccc([N+](=O)[O-])cc3)c2n1Cc1ccc(-c2ccccc2-c2nn[nH][n+]2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C53H43N7O8/c1-4-65-50-54-46-26-16-25-45(49(61)67-52(2,3)68-51(62)66-42-33-31-41(32-34-42)60(63)64)47(46)58(50)35-36-27-29-37(30-28-36)43-23-14-15-24-44(43)48-55-56-57-59(48)53(38-17-8-5-9-18-38,39-19-10-6-11-20-39)40-21-12-7-13-22-40/h5-34H,4,35H2,1-3H3/p+1 |
| InChIKey | SWHXETRVMXMQTN-UHFFFAOYSA-O |
| XLogP | 10.08 |
| TPSA | 177.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.98 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|