C37H38N8O12 — CID 143266648
4-nitrooxybutyl 3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate (PubChem CID 143266648) has the molecular formula C37H38N8O12 and a molecular weight of 786.75 g/mol. Its IUPAC name is 4-nitrooxybutyl 3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate.
| Compound Name | 4-nitrooxybutyl 3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 143266648 |
| Molecular Formula | C37H38N8O12 |
| Molecular Weight | 786.75 g/mol |
| Exact Mass | 786.26 |
| IUPAC Name | 4-nitrooxybutyl 3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OCCCCO[N+](=O)[O-])c2n1Cc1ccc(-c2ccccc2/C(N)=N/N(N)COC(=O)Oc2cccc(CO[N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C37H38N8O12/c1-2-52-36-40-32-14-8-13-31(35(46)53-19-5-6-20-55-44(48)49)33(32)42(36)22-25-15-17-27(18-16-25)29-11-3-4-12-30(29)34(38)41-43(39)24-54-37(47)57-28-10-7-9-26(21-28)23-56-45(50)51/h3-4,7-18,21H,2,5-6,19-20,22-24,39H2,1H3,(H2,38,41) |
| InChIKey | RHPVDFNNXATNKM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 261.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|