C42H47N7O10 — CID 143266234
1-formyloxyethyl 3-[[4-[2-[(Z)-N'-[amino-[2-(nitrooxymethyl)benzoyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;methoxycyclohexane (PubChem CID 143266234) has the molecular formula C42H47N7O10 and a molecular weight of 809.88 g/mol. Its IUPAC name is 1-formyloxyethyl 3-[[4-[2-[(Z)-N'-[amino-[2-(nitrooxymethyl)benzoyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;methoxycyclohexane.
| Compound Name | 1-formyloxyethyl 3-[[4-[2-[(Z)-N'-[amino-[2-(nitrooxymethyl)benzoyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;methoxycyclohexane |
|---|---|
| PubChem CID | 143266234 |
| Molecular Formula | C42H47N7O10 |
| Molecular Weight | 809.88 g/mol |
| Exact Mass | 809.34 |
| IUPAC Name | 1-formyloxyethyl 3-[[4-[2-[(Z)-N'-[amino-[2-(nitrooxymethyl)benzoyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate;methoxycyclohexane |
| SMILES | CCOc1nc2cccc(C(=O)OC(C)OC=O)c2n1Cc1ccc(-c2ccccc2/C(N)=N/N(N)C(=O)c2ccccc2CO[N+](=O)[O-])cc1.COC1CCCCC1 |
| InChI | InChI=1S/C35H33N7O9.C7H14O/c1-3-48-35-38-30-14-8-13-29(34(45)51-22(2)49-21-43)31(30)40(35)19-23-15-17-24(18-16-23)26-10-6-7-12-28(26)32(36)39-41(37)33(44)27-11-5-4-9-25(27)20-50-42(46)47;1-8-7-5-3-2-4-6-7/h4-18,21-22H,3,19-20,37H2,1-2H3,(H2,36,39);7H,2-6H2,1H3 |
| InChIKey | PPRDZXUSMHSVMO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 225.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.88 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|