C33H37N7O9 — CID 143266387
3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylic acid (PubChem CID 143266387) has the molecular formula C33H37N7O9 and a molecular weight of 675.70 g/mol. Its IUPAC name is 3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylic acid.
| Compound Name | 3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 143266387 |
| Molecular Formula | C33H37N7O9 |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | 3-[[4-[2-[(Z)-N'-[amino-[[3-(nitrooxymethyl)phenoxy]carbonyloxymethyl]amino]carbamimidoyl]phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-2-propylimidazole-4-carboxylic acid |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)O)n1Cc1ccc(-c2ccccc2/C(N)=N/N(N)COC(=O)Oc2cccc(CO[N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C33H37N7O9/c1-4-8-27-36-29(33(2,3)44)28(31(41)42)38(27)18-21-13-15-23(16-14-21)25-11-5-6-12-26(25)30(34)37-39(35)20-47-32(43)49-24-10-7-9-22(17-24)19-48-40(45)46/h5-7,9-17,44H,4,8,18-20,35H2,1-3H3,(H2,34,37)(H,41,42) |
| InChIKey | NYAKWEXFRVNDTA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 230.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|