C33H36N8O7 — CID 89152105
4-(dihydroxyamino)oxybutyl (2S)-1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 89152105) has the molecular formula C33H36N8O7 and a molecular weight of 656.70 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl (2S)-1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | 4-(dihydroxyamino)oxybutyl (2S)-1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 89152105 |
| Molecular Formula | C33H36N8O7 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl (2S)-1-[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)N3CCC[C@H]3C(=O)OCCCCON(O)O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H36N8O7/c1-2-46-33-34-27-12-7-11-26(31(42)39-18-8-13-28(39)32(43)47-19-5-6-20-48-41(44)45)29(27)40(33)21-22-14-16-23(17-15-22)24-9-3-4-10-25(24)30-35-37-38-36-30/h3-4,7,9-12,14-17,28,44-45H,2,5-6,8,13,18-21H2,1H3,(H,35,36,37,38)/t28-/m0/s1 |
| InChIKey | YKQVVXXJOSDKDY-NDEPHWFRSA-N |
| XLogP | 4.27 |
| TPSA | 181.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|