C37H45N9O12 — CID 89152099
bis[4-(dihydroxyamino)oxybutyl] 2-[[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]amino]pentanedioate (PubChem CID 89152099) has the molecular formula C37H45N9O12 and a molecular weight of 807.82 g/mol. Its IUPAC name is bis[4-(dihydroxyamino)oxybutyl] 2-[[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]amino]pentanedioate.
| Compound Name | bis[4-(dihydroxyamino)oxybutyl] 2-[[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 89152099 |
| Molecular Formula | C37H45N9O12 |
| Molecular Weight | 807.82 g/mol |
| Exact Mass | 807.32 |
| IUPAC Name | bis[4-(dihydroxyamino)oxybutyl] 2-[[2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carbonyl]amino]pentanedioate |
| SMILES | CCOc1nc2cccc(C(=O)NC(CCC(=O)OCCCCON(O)O)C(=O)OCCCCON(O)O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C37H45N9O12/c1-2-54-37-39-30-13-9-12-29(33(30)44(37)24-25-14-16-26(17-15-25)27-10-3-4-11-28(27)34-40-42-43-41-34)35(48)38-31(36(49)56-21-6-8-23-58-46(52)53)18-19-32(47)55-20-5-7-22-57-45(50)51/h3-4,9-17,31,50-53H,2,5-8,18-24H2,1H3,(H,38,48)(H,40,41,42,43) |
| InChIKey | UPICGTBPDOEAEN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 269.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|