C29H27N7O9 — CID 11498181
2-ethoxy-3-[[4-[2-[2-[2-(2-nitrooxyethoxy)ethoxycarbonyl]tetrazol-5-yl]phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid (PubChem CID 11498181) has the molecular formula C29H27N7O9 and a molecular weight of 617.58 g/mol. Its IUPAC name is 2-ethoxy-3-[[4-[2-[2-[2-(2-nitrooxyethoxy)ethoxycarbonyl]tetrazol-5-yl]phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid.
| Compound Name | 2-ethoxy-3-[[4-[2-[2-[2-(2-nitrooxyethoxy)ethoxycarbonyl]tetrazol-5-yl]phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11498181 |
| Molecular Formula | C29H27N7O9 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 2-ethoxy-3-[[4-[2-[2-[2-(2-nitrooxyethoxy)ethoxycarbonyl]tetrazol-5-yl]phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
| SMILES | CCOc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2nnn(C(=O)OCCOCCO[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C29H27N7O9/c1-2-43-28-30-24-9-5-8-23(27(37)38)25(24)34(28)18-19-10-12-20(13-11-19)21-6-3-4-7-22(21)26-31-33-35(32-26)29(39)44-16-14-42-15-17-45-36(40)41/h3-13H,2,14-18H2,1H3,(H,37,38) |
| InChIKey | YJTCLQRBJQWDKT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 195.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|