C36H36ClN7O10 — CID 143266414
1-formyloxyethyl 2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 143266414) has the molecular formula C36H36ClN7O10 and a molecular weight of 762.18 g/mol. Its IUPAC name is 1-formyloxyethyl 2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 1-formyloxyethyl 2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 143266414 |
| Molecular Formula | C36H36ClN7O10 |
| Molecular Weight | 762.18 g/mol |
| Exact Mass | 761.22 |
| IUPAC Name | 1-formyloxyethyl 2-butyl-5-chloro-3-[[4-[2-[2-[1-[[2-(nitrooxymethyl)phenyl]methoxycarbonyloxy]ethyl]tetrazol-5-yl]phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OC(C)OC=O)n1Cc1ccc(-c2ccccc2-c2nnn(C(C)OC(=O)OCc3ccccc3CO[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C36H36ClN7O10/c1-4-5-14-31-38-33(37)32(35(46)54-24(3)51-22-45)42(31)19-25-15-17-26(18-16-25)29-12-8-9-13-30(29)34-39-41-43(40-34)23(2)53-36(47)50-20-27-10-6-7-11-28(27)21-52-44(48)49/h6-13,15-18,22-24H,4-5,14,19-21H2,1-3H3 |
| InChIKey | HDAXSFDFAMZIDT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 201.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.18 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|