C26H26ClN7O5 — CID 143266904
[4-[5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-4-oxobutyl] nitrate (PubChem CID 143266904) has the molecular formula C26H26ClN7O5 and a molecular weight of 551.99 g/mol. Its IUPAC name is [4-[5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-4-oxobutyl] nitrate.
| Compound Name | [4-[5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 143266904 |
| Molecular Formula | C26H26ClN7O5 |
| Molecular Weight | 551.99 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | [4-[5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-4-oxobutyl] nitrate |
| SMILES | CCCCc1nc(Cl)c(C=O)n1Cc1ccc(-c2ccccc2-c2nnn(C(=O)CCCO[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C26H26ClN7O5/c1-2-3-9-23-28-25(27)22(17-35)32(23)16-18-11-13-19(14-12-18)20-7-4-5-8-21(20)26-29-31-33(30-26)24(36)10-6-15-39-34(37)38/h4-5,7-8,11-14,17H,2-3,6,9-10,15-16H2,1H3 |
| InChIKey | CBUNREGAZAYAHM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 147.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.99 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|